C10H17NOS — CID 58762877
S-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ethanethioate (PubChem CID 58762877) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is S-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ethanethioate.
| Compound Name | S-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 58762877 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | S-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ethanethioate |
| SMILES | CC(=O)SC1C[C@H]2CC[C@@H](C1)N2C |
| InChI | InChI=1S/C10H17NOS/c1-7(12)13-10-5-8-3-4-9(6-10)11(8)2/h8-10H,3-6H2,1-2H3/t8-,9+,10? |
| InChIKey | YQKJZRBZTBUEEA-ULKQDVFKSA-N |
| XLogP | 1.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|