C10H19ClN2OS — CID 67758612
2-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)sulfanyl]acetamide;hydrochloride (PubChem CID 67758612) has the molecular formula C10H19ClN2OS and a molecular weight of 250.79 g/mol. Its IUPAC name is 2-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)sulfanyl]acetamide;hydrochloride.
| Compound Name | 2-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)sulfanyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 67758612 |
| Molecular Formula | C10H19ClN2OS |
| Molecular Weight | 250.79 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)sulfanyl]acetamide;hydrochloride |
| SMILES | CN1C2CCC1CC(SCC(N)=O)C2.Cl |
| InChI | InChI=1S/C10H18N2OS.ClH/c1-12-7-2-3-8(12)5-9(4-7)14-6-10(11)13;/h7-9H,2-6H2,1H3,(H2,11,13);1H |
| InChIKey | XEOGKLDDZYBULI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.79 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |