C12H19SY- — CID 58763003
6-methyl-3,4-di(propan-2-yl)-2,5-dihydrothiopyran-5-ide;yttrium (PubChem CID 58763003) has the molecular formula C12H19SY- and a molecular weight of 284.26 g/mol. Its IUPAC name is 6-methyl-3,4-di(propan-2-yl)-2,5-dihydrothiopyran-5-ide;yttrium.
| Compound Name | 6-methyl-3,4-di(propan-2-yl)-2,5-dihydrothiopyran-5-ide;yttrium |
|---|---|
| PubChem CID | 58763003 |
| Molecular Formula | C12H19SY- |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 6-methyl-3,4-di(propan-2-yl)-2,5-dihydrothiopyran-5-ide;yttrium |
| SMILES | CC1=[C-]C(C(C)C)=C(C(C)C)CS1.[Y] |
| InChI | InChI=1S/C12H19S.Y/c1-8(2)11-6-10(5)13-7-12(11)9(3)4;/h8-9H,7H2,1-5H3;/q-1; |
| InChIKey | VPAJRYSEGCYLRI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|