About methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten
methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten (PubChem CID 58763662) has the molecular formula C14H13N2O2W-
and a molecular weight of 425.11 g/mol. Its IUPAC name is methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten.
Molecular Properties
| Compound Name | methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten |
| PubChem CID | 58763662 |
| Molecular Formula | C14H13N2O2W- |
| Molecular Weight | 425.11 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten |
| SMILES | COC(=O)c1[c-]cccc1NCc1ccncc1.[W] |
| InChI | InChI=1S/C14H13N2O2.W/c1-18-14(17)12-4-2-3-5-13(12)16-10-11-6-8-15-9-7-11;/h2-3,5-9,16H,10H2,1H3;/q-1; |
| InChIKey | SNGRZRCUFACARN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.11 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten?
The IUPAC name of methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten (CID 58763662) is methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten.
What is the SMILES notation for methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten?
The canonical SMILES for methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten is COC(=O)c1[c-]cccc1NCc1ccncc1.[W].
What is the InChIKey of methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten?
The InChIKey is SNGRZRCUFACARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N2O2.W/c1-18-14(17)12-4-2-3-5-13(12)16-10-11-6-8-15-9-7-11;/h2-3,5-9,16H,10H2,1H3;/q-1;.
What are the key properties of methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten?
methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten has a molecular weight of 425.11 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(pyridin-4-ylmethylamino)benzene-6-ide-1-carboxylate;tungsten is sourced from PubChem (CID 58763662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).