C15H15F3N2O2S — CID 58764976
2-ethyl-4-[2-(methylsulfanylmethyl)-4-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one (PubChem CID 58764976) has the molecular formula C15H15F3N2O2S and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-ethyl-4-[2-(methylsulfanylmethyl)-4-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one.
| Compound Name | 2-ethyl-4-[2-(methylsulfanylmethyl)-4-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 58764976 |
| Molecular Formula | C15H15F3N2O2S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-ethyl-4-[2-(methylsulfanylmethyl)-4-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one |
| SMILES | CCn1[nH]cc(C(=O)c2ccc(C(F)(F)F)cc2CSC)c1=O |
| InChI | InChI=1S/C15H15F3N2O2S/c1-3-20-14(22)12(7-19-20)13(21)11-5-4-10(15(16,17)18)6-9(11)8-23-2/h4-7,19H,3,8H2,1-2H3 |
| InChIKey | RDNWYGHAVROUQN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |