C18H32N2O6 — CID 58765109
(E,2R)-3,4,5-trihydroxy-2-methoxy-8-methyl-N-[(3S)-2-oxoazepan-3-yl]dec-6-enamide (PubChem CID 58765109) has the molecular formula C18H32N2O6 and a molecular weight of 372.46 g/mol. Its IUPAC name is (E,2R)-3,4,5-trihydroxy-2-methoxy-8-methyl-N-[(3S)-2-oxoazepan-3-yl]dec-6-enamide.
| Compound Name | (E,2R)-3,4,5-trihydroxy-2-methoxy-8-methyl-N-[(3S)-2-oxoazepan-3-yl]dec-6-enamide |
|---|---|
| PubChem CID | 58765109 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (E,2R)-3,4,5-trihydroxy-2-methoxy-8-methyl-N-[(3S)-2-oxoazepan-3-yl]dec-6-enamide |
| SMILES | CCC(C)/C=C/C(O)C(O)C(O)[C@@H](OC)C(=O)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C18H32N2O6/c1-4-11(2)8-9-13(21)14(22)15(23)16(26-3)18(25)20-12-7-5-6-10-19-17(12)24/h8-9,11-16,21-23H,4-7,10H2,1-3H3,(H,19,24)(H,20,25)/b9-8+/t11?,12-,13?,14?,15?,16+/m0/s1 |
| InChIKey | GPVKLYONJSSZFL-GBFGMXGMSA-N |
| XLogP | -0.53 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|