C24H38N2O9 — CID 91434002
[(2R,3R,4S,5R)-3,4-diacetyloxy-2-methoxy-8-methyl-1-oxo-1-[[(3S)-2-oxoazepan-3-yl]amino]dec-6-en-5-yl] acetate (PubChem CID 91434002) has the molecular formula C24H38N2O9 and a molecular weight of 498.57 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-diacetyloxy-2-methoxy-8-methyl-1-oxo-1-[[(3S)-2-oxoazepan-3-yl]amino]dec-6-en-5-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-2-methoxy-8-methyl-1-oxo-1-[[(3S)-2-oxoazepan-3-yl]amino]dec-6-en-5-yl] acetate |
|---|---|
| PubChem CID | 91434002 |
| Molecular Formula | C24H38N2O9 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-2-methoxy-8-methyl-1-oxo-1-[[(3S)-2-oxoazepan-3-yl]amino]dec-6-en-5-yl] acetate |
| SMILES | CCC(C)C=C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC)C(=O)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C24H38N2O9/c1-7-14(2)11-12-19(33-15(3)27)20(34-16(4)28)21(35-17(5)29)22(32-6)24(31)26-18-10-8-9-13-25-23(18)30/h11-12,14,18-22H,7-10,13H2,1-6H3,(H,25,30)(H,26,31)/t14?,18-,19+,20-,21+,22+/m0/s1 |
| InChIKey | ZTVMDGXMPYIWRV-YVXHHJMHSA-N |
| XLogP | 1.18 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|