C25H31N3O3 — CID 58765378
4-(2,4-dibutoxyphenyl)-2,4,5,10-tetrahydro-1H-pyrrolo[3,4-c][1,5]benzodiazepin-3-one (PubChem CID 58765378) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-(2,4-dibutoxyphenyl)-2,4,5,10-tetrahydro-1H-pyrrolo[3,4-c][1,5]benzodiazepin-3-one.
| Compound Name | 4-(2,4-dibutoxyphenyl)-2,4,5,10-tetrahydro-1H-pyrrolo[3,4-c][1,5]benzodiazepin-3-one |
|---|---|
| PubChem CID | 58765378 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-(2,4-dibutoxyphenyl)-2,4,5,10-tetrahydro-1H-pyrrolo[3,4-c][1,5]benzodiazepin-3-one |
| SMILES | CCCCOc1ccc(C2Nc3ccccc3NC3=C2C(=O)NC3)c(OCCCC)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-3-5-13-30-17-11-12-18(22(15-17)31-14-6-4-2)24-23-21(16-26-25(23)29)27-19-9-7-8-10-20(19)28-24/h7-12,15,24,27-28H,3-6,13-14,16H2,1-2H3,(H,26,29) |
| InChIKey | QHVDRHJGDANDLR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|