C25H26ClN5 — CID 58765485
4-[7-chloro-2-(3-methylphenyl)pyrazolo[1,5-a]pyridin-3-yl]-N-cyclopentyl-5,6-dimethylpyrimidin-2-amine (PubChem CID 58765485) has the molecular formula C25H26ClN5 and a molecular weight of 431.97 g/mol. Its IUPAC name is 4-[7-chloro-2-(3-methylphenyl)pyrazolo[1,5-a]pyridin-3-yl]-N-cyclopentyl-5,6-dimethylpyrimidin-2-amine.
| Compound Name | 4-[7-chloro-2-(3-methylphenyl)pyrazolo[1,5-a]pyridin-3-yl]-N-cyclopentyl-5,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58765485 |
| Molecular Formula | C25H26ClN5 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4-[7-chloro-2-(3-methylphenyl)pyrazolo[1,5-a]pyridin-3-yl]-N-cyclopentyl-5,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cccc(-c2nn3c(Cl)cccc3c2-c2nc(NC3CCCC3)nc(C)c2C)c1 |
| InChI | InChI=1S/C25H26ClN5/c1-15-8-6-9-18(14-15)24-22(20-12-7-13-21(26)31(20)30-24)23-16(2)17(3)27-25(29-23)28-19-10-4-5-11-19/h6-9,12-14,19H,4-5,10-11H2,1-3H3,(H,27,28,29) |
| InChIKey | OMODOIMGTYNSSP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|