C17H19NO6 — CID 58766051
(3'aR,4S)-3'-benzyl-2,2-dimethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-pyrano[3,4-d][1,3]oxazole]-2',7'-dione (PubChem CID 58766051) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is (3'aR,4S)-3'-benzyl-2,2-dimethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-pyrano[3,4-d][1,3]oxazole]-2',7'-dione.
| Compound Name | (3'aR,4S)-3'-benzyl-2,2-dimethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-pyrano[3,4-d][1,3]oxazole]-2',7'-dione |
|---|---|
| PubChem CID | 58766051 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (3'aR,4S)-3'-benzyl-2,2-dimethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-pyrano[3,4-d][1,3]oxazole]-2',7'-dione |
| SMILES | CC1(C)OC[C@]2(OC[C@@H]3C(OC(=O)N3Cc3ccccc3)C2=O)O1 |
| InChI | InChI=1S/C17H19NO6/c1-16(2)22-10-17(24-16)14(19)13-12(9-21-17)18(15(20)23-13)8-11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-,13?,17+/m1/s1 |
| InChIKey | IKMJWHRDPBAKDA-KOHRXURCSA-N |
| XLogP | 1.45 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |