C23H35NO6Si — CID 58766071
(3'aR,4S,7'S)-3'-benzyl-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole]-2'-one (PubChem CID 58766071) has the molecular formula C23H35NO6Si and a molecular weight of 449.62 g/mol. Its IUPAC name is (3'aR,4S,7'S)-3'-benzyl-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole]-2'-one.
| Compound Name | (3'aR,4S,7'S)-3'-benzyl-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole]-2'-one |
|---|---|
| PubChem CID | 58766071 |
| Molecular Formula | C23H35NO6Si |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (3'aR,4S,7'S)-3'-benzyl-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole]-2'-one |
| SMILES | CC1(C)OC[C@]2(OC[C@@H]3C(OC(=O)N3Cc3ccccc3)[C@@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H35NO6Si/c1-21(2,3)31(6,7)29-19-18-17(14-26-23(19)15-27-22(4,5)30-23)24(20(25)28-18)13-16-11-9-8-10-12-16/h8-12,17-19H,13-15H2,1-7H3/t17-,18?,19+,23+/m1/s1 |
| InChIKey | YMKQGGXQVMLUPX-NNPZDHNLSA-N |
| XLogP | 4.28 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|