C19H23NO6 — CID 170851348
(1R,2R,6R,7R,8R)-5-benzyl-7-(oxan-2-yloxy)-3,10,11-trioxa-5-azatricyclo[6.2.1.02,6]undecan-4-one (PubChem CID 170851348) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (1R,2R,6R,7R,8R)-5-benzyl-7-(oxan-2-yloxy)-3,10,11-trioxa-5-azatricyclo[6.2.1.02,6]undecan-4-one.
| Compound Name | (1R,2R,6R,7R,8R)-5-benzyl-7-(oxan-2-yloxy)-3,10,11-trioxa-5-azatricyclo[6.2.1.02,6]undecan-4-one |
|---|---|
| PubChem CID | 170851348 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (1R,2R,6R,7R,8R)-5-benzyl-7-(oxan-2-yloxy)-3,10,11-trioxa-5-azatricyclo[6.2.1.02,6]undecan-4-one |
| SMILES | O=C1O[C@H]2[C@@H]3OC[C@@H](O3)[C@H](OC3CCCCO3)[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO6/c21-19-20(10-12-6-2-1-3-7-12)15-16(25-14-8-4-5-9-22-14)13-11-23-18(24-13)17(15)26-19/h1-3,6-7,13-18H,4-5,8-11H2/t13-,14?,15-,16+,17-,18-/m1/s1 |
| InChIKey | IKFUKFWRRGYNQV-YEUAOBPJSA-N |
| XLogP | 2.04 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |