C19H21NO2 — CID 58767585
(1S,2R)-1-(2-methylphenoxy)spiro[1,3-dihydroindene-2,2'-morpholine] (PubChem CID 58767585) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (1S,2R)-1-(2-methylphenoxy)spiro[1,3-dihydroindene-2,2'-morpholine].
| Compound Name | (1S,2R)-1-(2-methylphenoxy)spiro[1,3-dihydroindene-2,2'-morpholine] |
|---|---|
| PubChem CID | 58767585 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (1S,2R)-1-(2-methylphenoxy)spiro[1,3-dihydroindene-2,2'-morpholine] |
| SMILES | Cc1ccccc1O[C@H]1c2ccccc2C[C@@]12CNCCO2 |
| InChI | InChI=1S/C19H21NO2/c1-14-6-2-5-9-17(14)22-18-16-8-4-3-7-15(16)12-19(18)13-20-10-11-21-19/h2-9,18,20H,10-13H2,1H3/t18-,19+/m0/s1 |
| InChIKey | PZZQXHUPPYQGNW-RBUKOAKNSA-N |
| XLogP | 3.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |