C24H30Cl2FN5O2 — CID 58767655
5-chloro-4-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2-nitroaniline (PubChem CID 58767655) has the molecular formula C24H30Cl2FN5O2 and a molecular weight of 510.44 g/mol. Its IUPAC name is 5-chloro-4-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2-nitroaniline.
| Compound Name | 5-chloro-4-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 58767655 |
| Molecular Formula | C24H30Cl2FN5O2 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 5-chloro-4-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2-nitroaniline |
| SMILES | CC[C@H]1CN(c2cc([N+](=O)[O-])c(N)cc2Cl)CCN1C1CCN(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C24H30Cl2FN5O2/c1-2-18-15-30(23-13-24(32(33)34)22(28)12-20(23)26)9-10-31(18)19-5-7-29(8-6-19)14-16-3-4-17(25)11-21(16)27/h3-4,11-13,18-19H,2,5-10,14-15,28H2,1H3/t18-/m0/s1 |
| InChIKey | SLCYQLLCDBEQAQ-SFHVURJKSA-N |
| XLogP | 5.19 |
| TPSA | 78.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|