C50H50F2N2O8S2 — CID 58769526
2-[3-[4-[6,8-bis(butyl-dihydroxy-oxo-λ6-sulfanyl)naphthalen-2-yl]oxy-3-pentylbenzoyl]-4-(2-cyano-3-fluorophenyl)phenyl]-6-fluorobenzonitrile (PubChem CID 58769526) has the molecular formula C50H50F2N2O8S2 and a molecular weight of 909.09 g/mol. Its IUPAC name is 2-[3-[4-[6,8-bis(butyl-dihydroxy-oxo-λ6-sulfanyl)naphthalen-2-yl]oxy-3-pentylbenzoyl]-4-(2-cyano-3-fluorophenyl)phenyl]-6-fluorobenzonitrile.
| Compound Name | 2-[3-[4-[6,8-bis(butyl-dihydroxy-oxo-λ6-sulfanyl)naphthalen-2-yl]oxy-3-pentylbenzoyl]-4-(2-cyano-3-fluorophenyl)phenyl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 58769526 |
| Molecular Formula | C50H50F2N2O8S2 |
| Molecular Weight | 909.09 g/mol |
| Exact Mass | 908.30 |
| IUPAC Name | 2-[3-[4-[6,8-bis(butyl-dihydroxy-oxo-λ6-sulfanyl)naphthalen-2-yl]oxy-3-pentylbenzoyl]-4-(2-cyano-3-fluorophenyl)phenyl]-6-fluorobenzonitrile |
| SMILES | CCCCCc1cc(C(=O)c2cc(-c3cccc(F)c3C#N)ccc2-c2cccc(F)c2C#N)ccc1Oc1ccc2cc(S(=O)(O)(O)CCCC)cc(S(=O)(O)(O)CCCC)c2c1 |
| InChI | InChI=1S/C50H50F2N2O8S2/c1-4-7-10-13-35-26-36(50(55)43-28-34(39-14-11-16-46(51)44(39)31-53)19-22-41(43)40-15-12-17-47(52)45(40)32-54)20-23-48(35)62-37-21-18-33-27-38(63(56,57,58)24-8-5-2)30-49(42(33)29-37)64(59,60,61)25-9-6-3/h11-12,14-23,26-30H,4-10,13,24-25H2,1-3H3,(H2,56,57,58)(H2,59,60,61) |
| InChIKey | JMWVEEAHVSRZLN-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 188.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.09 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|