C42H38F2N2O5S — CID 58769565
2-[3-[4-[4-(butyl-dihydroxy-oxo-λ6-sulfanyl)phenoxy]-3-pentylbenzoyl]-4-(2-cyano-3-fluorophenyl)phenyl]-6-fluorobenzonitrile (PubChem CID 58769565) has the molecular formula C42H38F2N2O5S and a molecular weight of 720.84 g/mol. Its IUPAC name is 2-[3-[4-[4-(butyl-dihydroxy-oxo-λ6-sulfanyl)phenoxy]-3-pentylbenzoyl]-4-(2-cyano-3-fluorophenyl)phenyl]-6-fluorobenzonitrile.
| Compound Name | 2-[3-[4-[4-(butyl-dihydroxy-oxo-λ6-sulfanyl)phenoxy]-3-pentylbenzoyl]-4-(2-cyano-3-fluorophenyl)phenyl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 58769565 |
| Molecular Formula | C42H38F2N2O5S |
| Molecular Weight | 720.84 g/mol |
| Exact Mass | 720.25 |
| IUPAC Name | 2-[3-[4-[4-(butyl-dihydroxy-oxo-λ6-sulfanyl)phenoxy]-3-pentylbenzoyl]-4-(2-cyano-3-fluorophenyl)phenyl]-6-fluorobenzonitrile |
| SMILES | CCCCCc1cc(C(=O)c2cc(-c3cccc(F)c3C#N)ccc2-c2cccc(F)c2C#N)ccc1Oc1ccc(S(=O)(O)(O)CCCC)cc1 |
| InChI | InChI=1S/C42H38F2N2O5S/c1-3-5-7-10-29-24-30(16-22-41(29)51-31-17-19-32(20-18-31)52(48,49,50)23-6-4-2)42(47)36-25-28(33-11-8-13-39(43)37(33)26-45)15-21-35(36)34-12-9-14-40(44)38(34)27-46/h8-9,11-22,24-25H,3-7,10,23H2,1-2H3,(H2,48,49,50) |
| InChIKey | NVRJWRAOIJFFJT-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.84 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|