C54H48F2O7S — CID 58769592
[4-[3-[4-[4-(butyl-dihydroxy-oxo-λ6-sulfanyl)phenoxy]-3-pentylbenzoyl]-4-[4-(4-fluorobenzoyl)phenyl]phenyl]phenyl]-(4-fluorophenyl)methanone (PubChem CID 58769592) has the molecular formula C54H48F2O7S and a molecular weight of 879.03 g/mol. Its IUPAC name is [4-[3-[4-[4-(butyl-dihydroxy-oxo-λ6-sulfanyl)phenoxy]-3-pentylbenzoyl]-4-[4-(4-fluorobenzoyl)phenyl]phenyl]phenyl]-(4-fluorophenyl)methanone.
| Compound Name | [4-[3-[4-[4-(butyl-dihydroxy-oxo-λ6-sulfanyl)phenoxy]-3-pentylbenzoyl]-4-[4-(4-fluorobenzoyl)phenyl]phenyl]phenyl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 58769592 |
| Molecular Formula | C54H48F2O7S |
| Molecular Weight | 879.03 g/mol |
| Exact Mass | 878.31 |
| IUPAC Name | [4-[3-[4-[4-(butyl-dihydroxy-oxo-λ6-sulfanyl)phenoxy]-3-pentylbenzoyl]-4-[4-(4-fluorobenzoyl)phenyl]phenyl]phenyl]-(4-fluorophenyl)methanone |
| SMILES | CCCCCc1cc(C(=O)c2cc(-c3ccc(C(=O)c4ccc(F)cc4)cc3)ccc2-c2ccc(C(=O)c3ccc(F)cc3)cc2)ccc1Oc1ccc(S(=O)(O)(O)CCCC)cc1 |
| InChI | InChI=1S/C54H48F2O7S/c1-3-5-7-8-43-34-44(22-32-51(43)63-47-27-29-48(30-28-47)64(60,61,62)33-6-4-2)54(59)50-35-42(36-9-13-38(14-10-36)52(57)40-17-23-45(55)24-18-40)21-31-49(50)37-11-15-39(16-12-37)53(58)41-19-25-46(56)26-20-41/h9-32,34-35H,3-8,33H2,1-2H3,(H2,60,61,62) |
| InChIKey | JFGBZLWLWRVHLZ-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.03 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|