C39H22Cl2N2O2 — CID 58769613
9,9-bis[4-(3-chloro-4-isocyanophenoxy)phenyl]fluorene (PubChem CID 58769613) has the molecular formula C39H22Cl2N2O2 and a molecular weight of 621.52 g/mol. Its IUPAC name is 9,9-bis[4-(3-chloro-4-isocyanophenoxy)phenyl]fluorene.
| Compound Name | 9,9-bis[4-(3-chloro-4-isocyanophenoxy)phenyl]fluorene |
|---|---|
| PubChem CID | 58769613 |
| Molecular Formula | C39H22Cl2N2O2 |
| Molecular Weight | 621.52 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | 9,9-bis[4-(3-chloro-4-isocyanophenoxy)phenyl]fluorene |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(C3(c4ccc(Oc5ccc([N+]#[C-])c(Cl)c5)cc4)c4ccccc4-c4ccccc43)cc2)cc1Cl |
| InChI | InChI=1S/C39H22Cl2N2O2/c1-42-37-21-19-29(23-35(37)40)44-27-15-11-25(12-16-27)39(33-9-5-3-7-31(33)32-8-4-6-10-34(32)39)26-13-17-28(18-14-26)45-30-20-22-38(43-2)36(41)24-30/h3-24H |
| InChIKey | JPPZRDIVZJZMQF-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 27.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.52 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|