C49H40N4O4S — CID 162169591
3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;4-[9-(4-aminophenyl)fluoren-9-yl]aniline (PubChem CID 162169591) has the molecular formula C49H40N4O4S and a molecular weight of 780.95 g/mol. Its IUPAC name is 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;4-[9-(4-aminophenyl)fluoren-9-yl]aniline.
| Compound Name | 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;4-[9-(4-aminophenyl)fluoren-9-yl]aniline |
|---|---|
| PubChem CID | 162169591 |
| Molecular Formula | C49H40N4O4S |
| Molecular Weight | 780.95 g/mol |
| Exact Mass | 780.28 |
| IUPAC Name | 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline;4-[9-(4-aminophenyl)fluoren-9-yl]aniline |
| SMILES | Nc1ccc(C2(c3ccc(N)cc3)c3ccccc3-c3ccccc32)cc1.Nc1cccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4cccc(N)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C25H20N2.C24H20N2O4S/c26-19-13-9-17(10-14-19)25(18-11-15-20(27)16-12-18)23-7-3-1-5-21(23)22-6-2-4-8-24(22)25;25-17-3-1-5-21(15-17)29-19-7-11-23(12-8-19)31(27,28)24-13-9-20(10-14-24)30-22-6-2-4-18(26)16-22/h1-16H,26-27H2;1-16H,25-26H2 |
| InChIKey | ZNPIJUNUDQRMKB-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.95 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|