C37H26O4S2 — CID 122401705
9,9-bis[4-(benzenesulfonyl)phenyl]fluorene (PubChem CID 122401705) has the molecular formula C37H26O4S2 and a molecular weight of 598.75 g/mol. Its IUPAC name is 9,9-bis[4-(benzenesulfonyl)phenyl]fluorene.
| Compound Name | 9,9-bis[4-(benzenesulfonyl)phenyl]fluorene |
|---|---|
| PubChem CID | 122401705 |
| Molecular Formula | C37H26O4S2 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 9,9-bis[4-(benzenesulfonyl)phenyl]fluorene |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(C2(c3ccc(S(=O)(=O)c4ccccc4)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C37H26O4S2/c38-42(39,29-11-3-1-4-12-29)31-23-19-27(20-24-31)37(35-17-9-7-15-33(35)34-16-8-10-18-36(34)37)28-21-25-32(26-22-28)43(40,41)30-13-5-2-6-14-30/h1-26H |
| InChIKey | VPUDRVLLECXNRY-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |