C45H34N2O2S — CID 155273596
2-[5-[4-(benzenesulfonyl)phenyl]indeno[1,2-c]pyridin-5-yl]-9,9-dimethyl-10-phenylacridine (PubChem CID 155273596) has the molecular formula C45H34N2O2S and a molecular weight of 666.85 g/mol. Its IUPAC name is 2-[5-[4-(benzenesulfonyl)phenyl]indeno[1,2-c]pyridin-5-yl]-9,9-dimethyl-10-phenylacridine.
| Compound Name | 2-[5-[4-(benzenesulfonyl)phenyl]indeno[1,2-c]pyridin-5-yl]-9,9-dimethyl-10-phenylacridine |
|---|---|
| PubChem CID | 155273596 |
| Molecular Formula | C45H34N2O2S |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | 2-[5-[4-(benzenesulfonyl)phenyl]indeno[1,2-c]pyridin-5-yl]-9,9-dimethyl-10-phenylacridine |
| SMILES | CC1(C)c2ccccc2N(c2ccccc2)c2ccc(C3(c4ccc(S(=O)(=O)c5ccccc5)cc4)c4ccccc4-c4cnccc43)cc21 |
| InChI | InChI=1S/C45H34N2O2S/c1-44(2)40-19-11-12-20-42(40)47(33-13-5-3-6-14-33)43-26-23-32(29-41(43)44)45(38-18-10-9-17-36(38)37-30-46-28-27-39(37)45)31-21-24-35(25-22-31)50(48,49)34-15-7-4-8-16-34/h3-30H,1-2H3 |
| InChIKey | YDOFEMUWJHUBRS-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |