C23H31N7O3 — CID 58770002
1-[1-[2-amino-3-[(E)-methoxyiminomethyl]-4-pyridinyl]piperidin-4-yl]-3-(6-cyclopentyloxy-3-pyridinyl)urea (PubChem CID 58770002) has the molecular formula C23H31N7O3 and a molecular weight of 453.55 g/mol. Its IUPAC name is 1-[1-[2-amino-3-[(E)-methoxyiminomethyl]-4-pyridinyl]piperidin-4-yl]-3-(6-cyclopentyloxy-3-pyridinyl)urea.
| Compound Name | 1-[1-[2-amino-3-[(E)-methoxyiminomethyl]-4-pyridinyl]piperidin-4-yl]-3-(6-cyclopentyloxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 58770002 |
| Molecular Formula | C23H31N7O3 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 1-[1-[2-amino-3-[(E)-methoxyiminomethyl]-4-pyridinyl]piperidin-4-yl]-3-(6-cyclopentyloxy-3-pyridinyl)urea |
| SMILES | CO/N=C/c1c(N2CCC(NC(=O)Nc3ccc(OC4CCCC4)nc3)CC2)ccnc1N |
| InChI | InChI=1S/C23H31N7O3/c1-32-27-15-19-20(8-11-25-22(19)24)30-12-9-16(10-13-30)28-23(31)29-17-6-7-21(26-14-17)33-18-4-2-3-5-18/h6-8,11,14-16,18H,2-5,9-10,12-13H2,1H3,(H2,24,25)(H2,28,29,31)/b27-15+ |
| InChIKey | RZPWNKBJOVILJL-JFLMPSFJSA-N |
| XLogP | 3.15 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|