C26H30ClFN6O6 — CID 58770418
4-[[2-(5-chloro-2-fluorophenyl)-5-methoxypyrimidin-4-yl]amino]-N-[2-[2-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]ethylamino]ethyl]pyridine-3-carboxamide (PubChem CID 58770418) has the molecular formula C26H30ClFN6O6 and a molecular weight of 577.01 g/mol. Its IUPAC name is 4-[[2-(5-chloro-2-fluorophenyl)-5-methoxypyrimidin-4-yl]amino]-N-[2-[2-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]ethylamino]ethyl]pyridine-3-carboxamide.
| Compound Name | 4-[[2-(5-chloro-2-fluorophenyl)-5-methoxypyrimidin-4-yl]amino]-N-[2-[2-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]ethylamino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58770418 |
| Molecular Formula | C26H30ClFN6O6 |
| Molecular Weight | 577.01 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | 4-[[2-(5-chloro-2-fluorophenyl)-5-methoxypyrimidin-4-yl]amino]-N-[2-[2-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]ethylamino]ethyl]pyridine-3-carboxamide |
| SMILES | COc1cnc(-c2cc(Cl)ccc2F)nc1Nc1ccncc1C(=O)NCCNCC[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H30ClFN6O6/c1-39-21-12-32-24(15-10-14(27)2-3-17(15)28)34-25(21)33-18-4-6-30-11-16(18)26(38)31-9-8-29-7-5-20-23(37)22(36)19(35)13-40-20/h2-4,6,10-12,19-20,22-23,29,35-37H,5,7-9,13H2,1H3,(H,31,38)(H,30,32,33,34)/t19-,20+,22+,23+/m1/s1 |
| InChIKey | KDKIAYZIMVNMGF-VAPSRWTKSA-N |
| XLogP | 1.27 |
| TPSA | 170.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.01 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|