C22H21ClFN5O2 — CID 142874263
4-[[2-(5-chloro-2-fluorophenyl)-5-cyclopropylpyrimidin-4-yl]amino]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 142874263) has the molecular formula C22H21ClFN5O2 and a molecular weight of 441.89 g/mol. Its IUPAC name is 4-[[2-(5-chloro-2-fluorophenyl)-5-cyclopropylpyrimidin-4-yl]amino]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 4-[[2-(5-chloro-2-fluorophenyl)-5-cyclopropylpyrimidin-4-yl]amino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142874263 |
| Molecular Formula | C22H21ClFN5O2 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-[[2-(5-chloro-2-fluorophenyl)-5-cyclopropylpyrimidin-4-yl]amino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1cnccc1Nc1nc(-c2cc(Cl)ccc2F)ncc1C1CC1 |
| InChI | InChI=1S/C22H21ClFN5O2/c1-31-9-8-26-22(30)17-11-25-7-6-19(17)28-21-16(13-2-3-13)12-27-20(29-21)15-10-14(23)4-5-18(15)24/h4-7,10-13H,2-3,8-9H2,1H3,(H,26,30)(H,25,27,28,29) |
| InChIKey | NMFICCLUSFHZNK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|