C20H17ClFN5O3 — CID 142874298
4-[5-(5-chloro-2-fluorophenyl)-2H-[1,3]oxazolo[4,5-d]pyrimidin-3-yl]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 142874298) has the molecular formula C20H17ClFN5O3 and a molecular weight of 429.84 g/mol. Its IUPAC name is 4-[5-(5-chloro-2-fluorophenyl)-2H-[1,3]oxazolo[4,5-d]pyrimidin-3-yl]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 4-[5-(5-chloro-2-fluorophenyl)-2H-[1,3]oxazolo[4,5-d]pyrimidin-3-yl]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142874298 |
| Molecular Formula | C20H17ClFN5O3 |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 4-[5-(5-chloro-2-fluorophenyl)-2H-[1,3]oxazolo[4,5-d]pyrimidin-3-yl]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1cnccc1N1COc2cnc(-c3cc(Cl)ccc3F)nc21 |
| InChI | InChI=1S/C20H17ClFN5O3/c1-29-7-6-24-20(28)14-9-23-5-4-16(14)27-11-30-17-10-25-18(26-19(17)27)13-8-12(21)2-3-15(13)22/h2-5,8-10H,6-7,11H2,1H3,(H,24,28) |
| InChIKey | JGFJGUMKVWVFNV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|