C12H18O4 — CID 58773503
(4R,5S)-1-[(1S)-1-hydroxyethyl]-5-methyl-4-propyl-6-oxabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 58773503) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (4R,5S)-1-[(1S)-1-hydroxyethyl]-5-methyl-4-propyl-6-oxabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (4R,5S)-1-[(1S)-1-hydroxyethyl]-5-methyl-4-propyl-6-oxabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 58773503 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (4R,5S)-1-[(1S)-1-hydroxyethyl]-5-methyl-4-propyl-6-oxabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CCC[C@H]1C(=O)CC2([C@H](C)O)C(=O)O[C@@]12C |
| InChI | InChI=1S/C12H18O4/c1-4-5-8-9(14)6-12(7(2)13)10(15)16-11(8,12)3/h7-8,13H,4-6H2,1-3H3/t7-,8-,11-,12?/m0/s1 |
| InChIKey | CPYDWAHBDJHRDH-MDJOXXCMSA-N |
| XLogP | 1.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|