C9H16O3 — CID 124879599
(3R,5S)-5-[(1S)-1-hydroxyethyl]-3-propyloxolan-2-one (PubChem CID 124879599) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (3R,5S)-5-[(1S)-1-hydroxyethyl]-3-propyloxolan-2-one.
| Compound Name | (3R,5S)-5-[(1S)-1-hydroxyethyl]-3-propyloxolan-2-one |
|---|---|
| PubChem CID | 124879599 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (3R,5S)-5-[(1S)-1-hydroxyethyl]-3-propyloxolan-2-one |
| SMILES | CCC[C@@H]1C[C@@H]([C@H](C)O)OC1=O |
| InChI | InChI=1S/C9H16O3/c1-3-4-7-5-8(6(2)10)12-9(7)11/h6-8,10H,3-5H2,1-2H3/t6-,7+,8-/m0/s1 |
| InChIKey | UVESOUCOCXAJEF-RNJXMRFFSA-N |
| XLogP | 1.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |