C6H11NO4 — CID 130893170
(3S,5S)-3-amino-5-[(1R)-1,2-dihydroxyethyl]oxolan-2-one (PubChem CID 130893170) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is (3S,5S)-3-amino-5-[(1R)-1,2-dihydroxyethyl]oxolan-2-one.
| Compound Name | (3S,5S)-3-amino-5-[(1R)-1,2-dihydroxyethyl]oxolan-2-one |
|---|---|
| PubChem CID | 130893170 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (3S,5S)-3-amino-5-[(1R)-1,2-dihydroxyethyl]oxolan-2-one |
| SMILES | N[C@H]1C[C@@H]([C@H](O)CO)OC1=O |
| InChI | InChI=1S/C6H11NO4/c7-3-1-5(4(9)2-8)11-6(3)10/h3-5,8-9H,1-2,7H2/t3-,4+,5-/m0/s1 |
| InChIKey | YFOCVDRXKZVXCT-LMVFSUKVSA-N |
| XLogP | -2.02 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |