C6H9ClO4 — CID 14559212
(3S,5S)-3-chloro-5-[(1R)-1,2-dihydroxyethyl]oxolan-2-one (PubChem CID 14559212) has the molecular formula C6H9ClO4 and a molecular weight of 180.59 g/mol. Its IUPAC name is (3S,5S)-3-chloro-5-[(1R)-1,2-dihydroxyethyl]oxolan-2-one.
| Compound Name | (3S,5S)-3-chloro-5-[(1R)-1,2-dihydroxyethyl]oxolan-2-one |
|---|---|
| PubChem CID | 14559212 |
| Molecular Formula | C6H9ClO4 |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | (3S,5S)-3-chloro-5-[(1R)-1,2-dihydroxyethyl]oxolan-2-one |
| SMILES | O=C1O[C@H]([C@H](O)CO)C[C@@H]1Cl |
| InChI | InChI=1S/C6H9ClO4/c7-3-1-5(4(9)2-8)11-6(3)10/h3-5,8-9H,1-2H2/t3-,4+,5-/m0/s1 |
| InChIKey | VRHYJTQTLCELFN-LMVFSUKVSA-N |
| XLogP | -0.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|