C6H8O6 — CID 71616927
(5R)-5-(1,2-dihydroxyethyl)-3-hydroxy(213C)oxolane-2,4-dione (PubChem CID 71616927) has the molecular formula C6H8O6 and a molecular weight of 177.12 g/mol. Its IUPAC name is (5R)-5-(1,2-dihydroxyethyl)-3-hydroxy(213C)oxolane-2,4-dione.
| Compound Name | (5R)-5-(1,2-dihydroxyethyl)-3-hydroxy(213C)oxolane-2,4-dione |
|---|---|
| PubChem CID | 71616927 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | (5R)-5-(1,2-dihydroxyethyl)-3-hydroxy(213C)oxolane-2,4-dione |
| SMILES | O=C1C(O)[13C](=O)O[C@@H]1C(O)CO |
| InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,4-5,7-8,10H,1H2/t2?,4?,5-/m1/s1/i6+1 |
| InChIKey | PJBQWWHYTVYMLO-BCXCAERHSA-N |
| XLogP | -2.81 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|