C9H9IO7 — CID 91078937
[2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 3-iodoprop-2-enoate (PubChem CID 91078937) has the molecular formula C9H9IO7 and a molecular weight of 356.07 g/mol. Its IUPAC name is [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 3-iodoprop-2-enoate.
| Compound Name | [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 3-iodoprop-2-enoate |
|---|---|
| PubChem CID | 91078937 |
| Molecular Formula | C9H9IO7 |
| Molecular Weight | 356.07 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 3-iodoprop-2-enoate |
| SMILES | O=C(C=CI)OCC(O)C1OC(=O)C(O)C1=O |
| InChI | InChI=1S/C9H9IO7/c10-2-1-5(12)16-3-4(11)8-6(13)7(14)9(15)17-8/h1-2,4,7-8,11,14H,3H2 |
| InChIKey | OPCACFCIROALHC-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.07 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|