C23H38O7 — CID 123962614
[2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 5,9,13-trimethyltetradec-4-enoate (PubChem CID 123962614) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 5,9,13-trimethyltetradec-4-enoate.
| Compound Name | [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 5,9,13-trimethyltetradec-4-enoate |
|---|---|
| PubChem CID | 123962614 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 5,9,13-trimethyltetradec-4-enoate |
| SMILES | CC(=CCCC(=O)OCC(O)C1OC(=O)C(O)C1=O)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C23H38O7/c1-15(2)8-5-9-16(3)10-6-11-17(4)12-7-13-19(25)29-14-18(24)22-20(26)21(27)23(28)30-22/h12,15-16,18,21-22,24,27H,5-11,13-14H2,1-4H3 |
| InChIKey | IWMFGIFOWVHVQM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|