C20H21N3O8S — CID 123498453
[(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate (PubChem CID 123498453) has the molecular formula C20H21N3O8S and a molecular weight of 463.47 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate.
| Compound Name | [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 123498453 |
| Molecular Formula | C20H21N3O8S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)OC[C@H](O)[C@H]3OC(=O)C(O)C3=O)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O8S/c1-23(2)14-7-3-12(4-8-14)21-22-13-5-9-15(10-6-13)32(28,29)30-11-16(24)19-17(25)18(26)20(27)31-19/h3-10,16,18-19,24,26H,11H2,1-2H3/b22-21+/t16-,18?,19+/m0/s1 |
| InChIKey | YFALTIMVLMBREN-GUKJUFOCSA-N |
| XLogP | 1.09 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|