C20H23N3O8S — CID 123871485
[2-(3,4-dihydroxy-5-oxooxolan-2-yl)-2-hydroxyethyl] 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate (PubChem CID 123871485) has the molecular formula C20H23N3O8S and a molecular weight of 465.48 g/mol. Its IUPAC name is [2-(3,4-dihydroxy-5-oxooxolan-2-yl)-2-hydroxyethyl] 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate.
| Compound Name | [2-(3,4-dihydroxy-5-oxooxolan-2-yl)-2-hydroxyethyl] 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 123871485 |
| Molecular Formula | C20H23N3O8S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | [2-(3,4-dihydroxy-5-oxooxolan-2-yl)-2-hydroxyethyl] 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)OCC(O)C3OC(=O)C(O)C3O)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O8S/c1-23(2)14-7-3-12(4-8-14)21-22-13-5-9-15(10-6-13)32(28,29)30-11-16(24)19-17(25)18(26)20(27)31-19/h3-10,16-19,24-26H,11H2,1-2H3/b22-21+ |
| InChIKey | IFZXSCOBOPVKSP-QURGRASLSA-N |
| XLogP | 0.88 |
| TPSA | 158.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|