C21H29N3O3S — CID 87503290
N,N-dimethyl-4-(propan-2-yliminomethylideneamino)aniline;ethyl 4-methylbenzenesulfonate (PubChem CID 87503290) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N,N-dimethyl-4-(propan-2-yliminomethylideneamino)aniline;ethyl 4-methylbenzenesulfonate.
| Compound Name | N,N-dimethyl-4-(propan-2-yliminomethylideneamino)aniline;ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87503290 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N,N-dimethyl-4-(propan-2-yliminomethylideneamino)aniline;ethyl 4-methylbenzenesulfonate |
| SMILES | CC(C)N=C=Nc1ccc(N(C)C)cc1.CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H17N3.C9H12O3S/c1-10(2)13-9-14-11-5-7-12(8-6-11)15(3)4;1-3-12-13(10,11)9-6-4-8(2)5-7-9/h5-8,10H,1-4H3;4-7H,3H2,1-2H3 |
| InChIKey | LBYMITSXOGKGSM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|