C33H41N2O5S2+ — CID 57143725
[bis[4-(dimethylamino)phenyl]-[4-(1-ethoxyethoxy)phenyl]-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium (PubChem CID 57143725) has the molecular formula C33H41N2O5S2+ and a molecular weight of 609.83 g/mol. Its IUPAC name is [bis[4-(dimethylamino)phenyl]-[4-(1-ethoxyethoxy)phenyl]-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium.
| Compound Name | [bis[4-(dimethylamino)phenyl]-[4-(1-ethoxyethoxy)phenyl]-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
|---|---|
| PubChem CID | 57143725 |
| Molecular Formula | C33H41N2O5S2+ |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | [bis[4-(dimethylamino)phenyl]-[4-(1-ethoxyethoxy)phenyl]-λ4-sulfanyl]-(4-methylphenyl)sulfonyloxidanium |
| SMILES | CCOC(C)Oc1ccc(S([OH+]S(=O)(=O)c2ccc(C)cc2)(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H40N2O5S2/c1-8-38-26(3)39-29-15-23-32(24-16-29)41(30-19-11-27(12-20-30)34(4)5,31-21-13-28(14-22-31)35(6)7)40-42(36,37)33-17-9-25(2)10-18-33/h9-24,26H,8H2,1-7H3/p+1 |
| InChIKey | VNERIHKVGFRIOW-UHFFFAOYSA-O |
| XLogP | 7.57 |
| TPSA | 71.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|