C16H26N2O6S — CID 22907178
2-[[4-(1-ethoxyethoxy)phenyl]sulfonyl-(2-methylpropyl)amino]-N-hydroxyacetamide (PubChem CID 22907178) has the molecular formula C16H26N2O6S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[[4-(1-ethoxyethoxy)phenyl]sulfonyl-(2-methylpropyl)amino]-N-hydroxyacetamide.
| Compound Name | 2-[[4-(1-ethoxyethoxy)phenyl]sulfonyl-(2-methylpropyl)amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 22907178 |
| Molecular Formula | C16H26N2O6S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[[4-(1-ethoxyethoxy)phenyl]sulfonyl-(2-methylpropyl)amino]-N-hydroxyacetamide |
| SMILES | CCOC(C)Oc1ccc(S(=O)(=O)N(CC(=O)NO)CC(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O6S/c1-5-23-13(4)24-14-6-8-15(9-7-14)25(21,22)18(10-12(2)3)11-16(19)17-20/h6-9,12-13,20H,5,10-11H2,1-4H3,(H,17,19) |
| InChIKey | MOTVBLBQZAMKJC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|