C27H28N2O5S2 — CID 57201672
[[4-(1-ethoxyethoxy)phenyl]-dipyridin-2-yl-λ4-sulfanyl] 4-methylbenzenesulfonate (PubChem CID 57201672) has the molecular formula C27H28N2O5S2 and a molecular weight of 524.66 g/mol. Its IUPAC name is [[4-(1-ethoxyethoxy)phenyl]-dipyridin-2-yl-λ4-sulfanyl] 4-methylbenzenesulfonate.
| Compound Name | [[4-(1-ethoxyethoxy)phenyl]-dipyridin-2-yl-λ4-sulfanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57201672 |
| Molecular Formula | C27H28N2O5S2 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | [[4-(1-ethoxyethoxy)phenyl]-dipyridin-2-yl-λ4-sulfanyl] 4-methylbenzenesulfonate |
| SMILES | CCOC(C)Oc1ccc(S(OS(=O)(=O)c2ccc(C)cc2)(c2ccccn2)c2ccccn2)cc1 |
| InChI | InChI=1S/C27H28N2O5S2/c1-4-32-22(3)33-23-13-17-24(18-14-23)35(26-9-5-7-19-28-26,27-10-6-8-20-29-27)34-36(30,31)25-15-11-21(2)12-16-25/h5-20,22H,4H2,1-3H3 |
| InChIKey | AARHJSJNLRODGI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|