C10H14O7 — CID 91034409
(2S)-2-ethyl-4-hydroxy-4-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]butanoic acid (PubChem CID 91034409) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is (2S)-2-ethyl-4-hydroxy-4-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]butanoic acid.
| Compound Name | (2S)-2-ethyl-4-hydroxy-4-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 91034409 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (2S)-2-ethyl-4-hydroxy-4-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]butanoic acid |
| SMILES | CC[C@@H](CC(O)[C@H]1OC(=O)C(O)C1=O)C(=O)O |
| InChI | InChI=1S/C10H14O7/c1-2-4(9(14)15)3-5(11)8-6(12)7(13)10(16)17-8/h4-5,7-8,11,13H,2-3H2,1H3,(H,14,15)/t4-,5?,7?,8+/m0/s1 |
| InChIKey | FLICAEGZFGDXGT-GNEAXFTKSA-N |
| XLogP | -1.30 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|