C6H9BO8 — CID 57052090
[(1S)-2-hydroxy-1-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethoxy]boronic acid (PubChem CID 57052090) has the molecular formula C6H9BO8 and a molecular weight of 219.94 g/mol. Its IUPAC name is [(1S)-2-hydroxy-1-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethoxy]boronic acid.
| Compound Name | [(1S)-2-hydroxy-1-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethoxy]boronic acid |
|---|---|
| PubChem CID | 57052090 |
| Molecular Formula | C6H9BO8 |
| Molecular Weight | 219.94 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | [(1S)-2-hydroxy-1-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethoxy]boronic acid |
| SMILES | O=C1O[C@H]([C@H](CO)OB(O)O)C(=O)C1O |
| InChI | InChI=1S/C6H9BO8/c8-1-2(15-7(12)13)5-3(9)4(10)6(11)14-5/h2,4-5,8,10,12-13H,1H2/t2-,4?,5+/m0/s1 |
| InChIKey | NYBGIZJTSNHYAJ-LZUUPNLKSA-N |
| XLogP | -3.81 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.94 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|