C6H9O9P — CID 7168051
[(5R)-5-[(1S)-1,2-dihydroxyethyl]-2,4-dioxooxolan-3-yl] dihydrogen phosphate (PubChem CID 7168051) has the molecular formula C6H9O9P and a molecular weight of 256.10 g/mol. Its IUPAC name is [(5R)-5-[(1S)-1,2-dihydroxyethyl]-2,4-dioxooxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(5R)-5-[(1S)-1,2-dihydroxyethyl]-2,4-dioxooxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 7168051 |
| Molecular Formula | C6H9O9P |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | [(5R)-5-[(1S)-1,2-dihydroxyethyl]-2,4-dioxooxolan-3-yl] dihydrogen phosphate |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(=O)C1OP(=O)(O)O |
| InChI | InChI=1S/C6H9O9P/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13/h2,4-5,7-8H,1H2,(H2,11,12,13)/t2-,4+,5?/m0/s1 |
| InChIKey | RJTCYGBFKSOFPL-VMDATRFYSA-N |
| XLogP | -2.69 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|