C6H9O9P — CID 54690328
[(2R)-2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate (PubChem CID 54690328) has the molecular formula C6H9O9P and a molecular weight of 256.10 g/mol. Its IUPAC name is [(2R)-2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate.
| Compound Name | [(2R)-2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 54690328 |
| Molecular Formula | C6H9O9P |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | [(2R)-2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
| SMILES | O=C1O[C@H](C(O)CO)C(O)=C1OP(=O)(O)O |
| InChI | InChI=1S/C6H9O9P/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13/h2,4,7-9H,1H2,(H2,11,12,13)/t2?,4-/m1/s1 |
| InChIKey | MIJPAVRNWPDMOR-URVZRBSTSA-N |
| XLogP | -1.86 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|