C6H8NaO9P — CID 54740887
sodium [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen phosphate (PubChem CID 54740887) has the molecular formula C6H8NaO9P and a molecular weight of 278.09 g/mol. Its IUPAC name is sodium [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen phosphate.
| Compound Name | sodium [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 54740887 |
| Molecular Formula | C6H8NaO9P |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | sodium [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen phosphate |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1OP(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C6H9O9P.Na/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;/h2,4,7-9H,1H2,(H2,11,12,13);/q;+1/p-1/t2-,4+;/m0./s1 |
| InChIKey | KBQBQLNBRSEZSK-LEJBHHMKSA-M |
| XLogP | -5.48 |
| TPSA | 156.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | -5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|