C6H11MgO10P — CID 172873209
CID 172873209 (PubChem CID 172873209) has the molecular formula C6H11MgO10P and a molecular weight of 298.42 g/mol.
| Compound Name | CID 172873209 |
|---|---|
| PubChem CID | 172873209 |
| Molecular Formula | C6H11MgO10P |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | — |
| SMILES | O.O=C1O[C@H]([C@@H](O)CO)C(O)=C1OP(=O)(O)O.[Mg] |
| InChI | InChI=1S/C6H9O9P.Mg.H2O/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;;/h2,4,7-9H,1H2,(H2,11,12,13);;1H2/t2-,4+;;/m0../s1 |
| InChIKey | MVDHKIZDNVWUIS-YCWPWOODSA-N |
| XLogP | -3.06 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|