About CID 172873209
CID 172873209 (PubChem CID 172873209) has the molecular formula C6H11MgO10P
and a molecular weight of 298.42 g/mol.
Molecular Properties
| Compound Name | CID 172873209 |
| PubChem CID | 172873209 |
| Molecular Formula | C6H11MgO10P |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | — |
| SMILES | O.O=C1O[C@H]([C@@H](O)CO)C(O)=C1OP(=O)(O)O.[Mg] |
| InChI | InChI=1S/C6H9O9P.Mg.H2O/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;;/h2,4,7-9H,1H2,(H2,11,12,13);;1H2/t2-,4+;;/m0../s1 |
| InChIKey | MVDHKIZDNVWUIS-YCWPWOODSA-N |
| XLogP | -3.06 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 172873209 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172873209?
The IUPAC name of CID 172873209 (CID 172873209) is not available.
What is the SMILES notation for CID 172873209?
The canonical SMILES for CID 172873209 is O.O=C1O[C@H]([C@@H](O)CO)C(O)=C1OP(=O)(O)O.[Mg].
What is the InChIKey of CID 172873209?
The InChIKey is MVDHKIZDNVWUIS-YCWPWOODSA-N. The full InChI is InChI=1S/C6H9O9P.Mg.H2O/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;;/h2,4,7-9H,1H2,(H2,11,12,13);;1H2/t2-,4+;;/m0../s1.
What are the key properties of CID 172873209?
CID 172873209 has a molecular weight of 298.42 g/mol, XLogP of -3.06, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172873209 is sourced from PubChem (CID 172873209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).