C6H8O9S — CID 90473291
[(2S)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen sulfate (PubChem CID 90473291) has the molecular formula C6H8O9S and a molecular weight of 256.19 g/mol. Its IUPAC name is [(2S)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen sulfate.
| Compound Name | [(2S)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90473291 |
| Molecular Formula | C6H8O9S |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | [(2S)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen sulfate |
| SMILES | O=C1O[C@@H]([C@@H](O)CO)C(O)=C1OS(=O)(=O)O |
| InChI | InChI=1S/C6H8O9S/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13/h2,4,7-9H,1H2,(H,11,12,13)/t2-,4-/m0/s1 |
| InChIKey | XDBMXUKHMOFBPJ-OKKQSCSOSA-N |
| XLogP | -2.15 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|