C6H6O10S — CID 169442879
(2R)-2-hydroxy-2-[(2R)-3-hydroxy-5-oxo-4-sulfooxy-2H-furan-2-yl]acetic acid (PubChem CID 169442879) has the molecular formula C6H6O10S and a molecular weight of 270.17 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[(2R)-3-hydroxy-5-oxo-4-sulfooxy-2H-furan-2-yl]acetic acid.
| Compound Name | (2R)-2-hydroxy-2-[(2R)-3-hydroxy-5-oxo-4-sulfooxy-2H-furan-2-yl]acetic acid |
|---|---|
| PubChem CID | 169442879 |
| Molecular Formula | C6H6O10S |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | (2R)-2-hydroxy-2-[(2R)-3-hydroxy-5-oxo-4-sulfooxy-2H-furan-2-yl]acetic acid |
| SMILES | O=C1O[C@H]([C@@H](O)C(=O)O)C(O)=C1OS(=O)(=O)O |
| InChI | InChI=1S/C6H6O10S/c7-1-3(2(8)5(9)10)15-6(11)4(1)16-17(12,13)14/h2-3,7-8H,(H,9,10)(H,12,13,14)/t2-,3+/m1/s1 |
| InChIKey | GGXUXURABLYBBP-GBXIJSLDSA-N |
| XLogP | -2.05 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|