C9H12O6 — CID 68975358
(2R)-2-[(1R)-1,2-dihydroxy-3-methylbut-2-enyl]-3,4-dihydroxy-2H-furan-5-one (PubChem CID 68975358) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is (2R)-2-[(1R)-1,2-dihydroxy-3-methylbut-2-enyl]-3,4-dihydroxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(1R)-1,2-dihydroxy-3-methylbut-2-enyl]-3,4-dihydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 68975358 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (2R)-2-[(1R)-1,2-dihydroxy-3-methylbut-2-enyl]-3,4-dihydroxy-2H-furan-5-one |
| SMILES | CC(C)=C(O)[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| InChI | InChI=1S/C9H12O6/c1-3(2)4(10)5(11)8-6(12)7(13)9(14)15-8/h5,8,10-13H,1-2H3/t5-,8+/m0/s1 |
| InChIKey | YWRMMRQWMSKGBB-YLWLKBPMSA-N |
| XLogP | 0.45 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|