C9H12O7 — CID 54732327
[2-hydroxy-2-(3-hydroxy-4-methoxy-5-oxo-2H-furan-2-yl)ethyl] acetate (PubChem CID 54732327) has the molecular formula C9H12O7 and a molecular weight of 232.19 g/mol. Its IUPAC name is [2-hydroxy-2-(3-hydroxy-4-methoxy-5-oxo-2H-furan-2-yl)ethyl] acetate.
| Compound Name | [2-hydroxy-2-(3-hydroxy-4-methoxy-5-oxo-2H-furan-2-yl)ethyl] acetate |
|---|---|
| PubChem CID | 54732327 |
| Molecular Formula | C9H12O7 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | [2-hydroxy-2-(3-hydroxy-4-methoxy-5-oxo-2H-furan-2-yl)ethyl] acetate |
| SMILES | COC1=C(O)C(C(O)COC(C)=O)OC1=O |
| InChI | InChI=1S/C9H12O7/c1-4(10)15-3-5(11)7-6(12)8(14-2)9(13)16-7/h5,7,11-12H,3H2,1-2H3 |
| InChIKey | DACJAYYIRPSRCX-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |