C14H16O10 — CID 15825769
[(2S)-2-acetyloxy-2-[(2R)-3,4-diacetyloxy-5-oxo-2H-furan-2-yl]ethyl] acetate (PubChem CID 15825769) has the molecular formula C14H16O10 and a molecular weight of 344.27 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-2-[(2R)-3,4-diacetyloxy-5-oxo-2H-furan-2-yl]ethyl] acetate.
| Compound Name | [(2S)-2-acetyloxy-2-[(2R)-3,4-diacetyloxy-5-oxo-2H-furan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 15825769 |
| Molecular Formula | C14H16O10 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [(2S)-2-acetyloxy-2-[(2R)-3,4-diacetyloxy-5-oxo-2H-furan-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@H]1OC(=O)C(OC(C)=O)=C1OC(C)=O |
| InChI | InChI=1S/C14H16O10/c1-6(15)20-5-10(21-7(2)16)11-12(22-8(3)17)13(14(19)24-11)23-9(4)18/h10-11H,5H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | ANCAOTMXBIZJPA-WDEREUQCSA-N |
| XLogP | -0.26 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|