C9H11NO8 — CID 143021421
[4-aminooxy-2-(1,2-dihydroxyethyl)-5-oxo-2H-furan-3-yl] 2-oxopropanoate (PubChem CID 143021421) has the molecular formula C9H11NO8 and a molecular weight of 261.19 g/mol. Its IUPAC name is [4-aminooxy-2-(1,2-dihydroxyethyl)-5-oxo-2H-furan-3-yl] 2-oxopropanoate.
| Compound Name | [4-aminooxy-2-(1,2-dihydroxyethyl)-5-oxo-2H-furan-3-yl] 2-oxopropanoate |
|---|---|
| PubChem CID | 143021421 |
| Molecular Formula | C9H11NO8 |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | [4-aminooxy-2-(1,2-dihydroxyethyl)-5-oxo-2H-furan-3-yl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OC1=C(ON)C(=O)OC1C(O)CO |
| InChI | InChI=1S/C9H11NO8/c1-3(12)8(14)17-6-5(4(13)2-11)16-9(15)7(6)18-10/h4-5,11,13H,2,10H2,1H3 |
| InChIKey | QBBLZVXNGFFVIX-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|